About ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate
ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate (PubChem CID 11821601) has the molecular formula C14H20O5
and a molecular weight of 268.31 g/mol. Its IUPAC name is ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate.
Molecular Properties
| Compound Name | ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate |
| PubChem CID | 11821601 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate |
| SMILES | C=CCC(CC(=O)CCC1OCCO1)C(=O)OC=C |
| InChI | InChI=1S/C14H20O5/c1-3-5-11(14(16)17-4-2)10-12(15)6-7-13-18-8-9-19-13/h3-4,11,13H,1-2,5-10H2 |
| InChIKey | LCWQQVKGKALYLL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate?
The IUPAC name of ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate (CID 11821601) is ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate.
What is the SMILES notation for ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate?
The canonical SMILES for ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate is C=CCC(CC(=O)CCC1OCCO1)C(=O)OC=C.
What is the InChIKey of ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate?
The InChIKey is LCWQQVKGKALYLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-3-5-11(14(16)17-4-2)10-12(15)6-7-13-18-8-9-19-13/h3-4,11,13H,1-2,5-10H2.
What are the key properties of ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate?
ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate has a molecular weight of 268.31 g/mol, XLogP of 1.98, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl 6-(1,3-dioxolan-2-yl)-4-oxo-2-prop-2-enylhexanoate is sourced from PubChem (CID 11821601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).