About 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione
5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione (PubChem CID 118216506) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione |
| PubChem CID | 118216506 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione |
| SMILES | CC(C)CC1OC(=O)NC1=O |
| InChI | InChI=1S/C7H11NO3/c1-4(2)3-5-6(9)8-7(10)11-5/h4-5H,3H2,1-2H3,(H,8,9,10) |
| InChIKey | LRLGZFVVCFTMLO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione?
The IUPAC name of 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione (CID 118216506) is 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione is CC(C)CC1OC(=O)NC1=O.
What is the InChIKey of 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione?
The InChIKey is LRLGZFVVCFTMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4(2)3-5-6(9)8-7(10)11-5/h4-5H,3H2,1-2H3,(H,8,9,10).
What are the key properties of 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione?
5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione has a molecular weight of 157.17 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpropyl)-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 118216506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).