C15H27NO3 — CID 11821655
4,4,8,8,12,12-hexamethyl-2,6,10-trioxa-13-azatricyclo[7.3.1.05,13]tridecane (PubChem CID 11821655) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is 4,4,8,8,12,12-hexamethyl-2,6,10-trioxa-13-azatricyclo[7.3.1.05,13]tridecane.
| Compound Name | 4,4,8,8,12,12-hexamethyl-2,6,10-trioxa-13-azatricyclo[7.3.1.05,13]tridecane |
|---|---|
| PubChem CID | 11821655 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 4,4,8,8,12,12-hexamethyl-2,6,10-trioxa-13-azatricyclo[7.3.1.05,13]tridecane |
| SMILES | CC1(C)COC2N3C1OCC(C)(C)C3OCC2(C)C |
| InChI | InChI=1S/C15H27NO3/c1-13(2)7-17-11-15(5,6)9-19-12-14(3,4)8-18-10(13)16(11)12/h10-12H,7-9H2,1-6H3 |
| InChIKey | MVAXQWVKSZYACY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |