C23H31N — CID 118217240
1,2,11-tri(propan-2-yl)-5,6-dihydrobenzo[b][1]benzazepine (PubChem CID 118217240) has the molecular formula C23H31N and a molecular weight of 321.51 g/mol. Its IUPAC name is 1,2,11-tri(propan-2-yl)-5,6-dihydrobenzo[b][1]benzazepine.
| Compound Name | 1,2,11-tri(propan-2-yl)-5,6-dihydrobenzo[b][1]benzazepine |
|---|---|
| PubChem CID | 118217240 |
| Molecular Formula | C23H31N |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | 1,2,11-tri(propan-2-yl)-5,6-dihydrobenzo[b][1]benzazepine |
| SMILES | CC(C)c1ccc2c(c1C(C)C)N(C(C)C)c1ccccc1CC2 |
| InChI | InChI=1S/C23H31N/c1-15(2)20-14-13-19-12-11-18-9-7-8-10-21(18)24(17(5)6)23(19)22(20)16(3)4/h7-10,13-17H,11-12H2,1-6H3 |
| InChIKey | MEWFYMNUHTWFAW-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |