C36H35FN6O4 — CID 118217344
3-[4-[3-fluoro-5-[[1-(2-phenylmethoxyethyl)pyrrol-2-yl]methoxy]phenoxy]phenyl]-1-(oxan-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 118217344) has the molecular formula C36H35FN6O4 and a molecular weight of 634.71 g/mol. Its IUPAC name is 3-[4-[3-fluoro-5-[[1-(2-phenylmethoxyethyl)pyrrol-2-yl]methoxy]phenoxy]phenyl]-1-(oxan-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-[4-[3-fluoro-5-[[1-(2-phenylmethoxyethyl)pyrrol-2-yl]methoxy]phenoxy]phenyl]-1-(oxan-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118217344 |
| Molecular Formula | C36H35FN6O4 |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | 3-[4-[3-fluoro-5-[[1-(2-phenylmethoxyethyl)pyrrol-2-yl]methoxy]phenoxy]phenyl]-1-(oxan-4-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(-c1ccc(Oc3cc(F)cc(OCc4cccn4CCOCc4ccccc4)c3)cc1)nn2C1CCOCC1 |
| InChI | InChI=1S/C36H35FN6O4/c37-27-19-31(46-23-29-7-4-14-42(29)15-18-45-22-25-5-2-1-3-6-25)21-32(20-27)47-30-10-8-26(9-11-30)34-33-35(38)39-24-40-36(33)43(41-34)28-12-16-44-17-13-28/h1-11,14,19-21,24,28H,12-13,15-18,22-23H2,(H2,38,39,40) |
| InChIKey | UCXCDVOYQKEQIV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|