C22H20F7NO5S — CID 118217547
1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-methoxyethanone (PubChem CID 118217547) has the molecular formula C22H20F7NO5S and a molecular weight of 543.46 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 118217547 |
| Molecular Formula | C22H20F7NO5S |
| Molecular Weight | 543.46 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C22H20F7NO5S/c1-35-12-18(31)30-11-10-19(13-30,36(33,34)17-8-6-16(23)7-9-17)14-2-4-15(5-3-14)20(32,21(24,25)26)22(27,28)29/h2-9,32H,10-13H2,1H3 |
| InChIKey | LCCYGMULGJHCLN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |