C21H18F7NO4S — CID 118217550
1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]ethanone (PubChem CID 118217550) has the molecular formula C21H18F7NO4S and a molecular weight of 513.43 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118217550 |
| Molecular Formula | C21H18F7NO4S |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 1-[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H18F7NO4S/c1-13(30)29-11-10-18(12-29,34(32,33)17-8-6-16(22)7-9-17)14-2-4-15(5-3-14)19(31,20(23,24)25)21(26,27)28/h2-9,31H,10-12H2,1H3 |
| InChIKey | WSIFDSOTEVLMPK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |