C26H27F7N2O6S2 — CID 118217555
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone (PubChem CID 118217555) has the molecular formula C26H27F7N2O6S2 and a molecular weight of 660.63 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 118217555 |
| Molecular Formula | C26H27F7N2O6S2 |
| Molecular Weight | 660.63 g/mol |
| Exact Mass | 660.12 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-(1-methylsulfonylpiperidin-4-yl)methanone |
| SMILES | CS(=O)(=O)N1CCC(C(=O)N2CC[C@](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C26H27F7N2O6S2/c1-42(38,39)35-13-10-17(11-14-35)22(36)34-15-12-23(16-34,43(40,41)21-8-6-20(27)7-9-21)18-2-4-19(5-3-18)24(37,25(28,29)30)26(31,32)33/h2-9,17,37H,10-16H2,1H3/t23-/m0/s1 |
| InChIKey | QVPVWDKIJLWWPO-QHCPKHFHSA-N |
| XLogP | 3.71 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.63 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |