C26H21F7N2O4S — CID 118217559
1-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyridin-4-ylethanone (PubChem CID 118217559) has the molecular formula C26H21F7N2O4S and a molecular weight of 590.52 g/mol. Its IUPAC name is 1-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyridin-4-ylethanone.
| Compound Name | 1-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyridin-4-ylethanone |
|---|---|
| PubChem CID | 118217559 |
| Molecular Formula | C26H21F7N2O4S |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 1-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidin-1-yl]-2-pyridin-4-ylethanone |
| SMILES | O=C(Cc1ccncc1)N1CC[C@](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H21F7N2O4S/c27-20-5-7-21(8-6-20)40(38,39)23(11-14-35(16-23)22(36)15-17-9-12-34-13-10-17)18-1-3-19(4-2-18)24(37,25(28,29)30)26(31,32)33/h1-10,12-13,37H,11,14-16H2/t23-/m0/s1 |
| InChIKey | QNELSWWQVPXWQP-QHCPKHFHSA-N |
| XLogP | 4.68 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |