C21H18F7NO5S — CID 118217561
methyl 3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxylate (PubChem CID 118217561) has the molecular formula C21H18F7NO5S and a molecular weight of 529.43 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl 3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118217561 |
| Molecular Formula | C21H18F7NO5S |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | methyl 3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H18F7NO5S/c1-34-17(30)29-11-10-18(12-29,35(32,33)16-8-6-15(22)7-9-16)13-2-4-14(5-3-13)19(31,20(23,24)25)21(26,27)28/h2-9,31H,10-12H2,1H3 |
| InChIKey | OJBNWWGQLDOQLL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |