C27H25F8NO6S — CID 118217595
4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 118217595) has the molecular formula C27H25F8NO6S and a molecular weight of 643.55 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217595 |
| Molecular Formula | C27H25F8NO6S |
| Molecular Weight | 643.55 g/mol |
| Exact Mass | 643.13 |
| IUPAC Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C27H25F8NO6S/c28-19-5-7-20(8-6-19)43(41,42)24(17-1-3-18(4-2-17)25(29,26(30,31)32)27(33,34)35)13-14-36(15-24)22(39)23(40)11-9-16(10-12-23)21(37)38/h1-8,16,40H,9-15H2,(H,37,38)/t16?,23?,24-/m0/s1 |
| InChIKey | BOILSPDFARREIP-ZBYWLKIMSA-N |
| XLogP | 5.02 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |