C29H29F8NO5S — CID 118217611
4-[(3R)-3-(3-ethyl-4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118217611) has the molecular formula C29H29F8NO5S and a molecular weight of 655.60 g/mol. Its IUPAC name is 4-[(3R)-3-(3-ethyl-4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(3-ethyl-4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217611 |
| Molecular Formula | C29H29F8NO5S |
| Molecular Weight | 655.60 g/mol |
| Exact Mass | 655.16 |
| IUPAC Name | 4-[(3R)-3-(3-ethyl-4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | CCc1cc(S(=O)(=O)[C@@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(C(=O)C3CCC(C(=O)O)CC3)C2)ccc1F |
| InChI | InChI=1S/C29H29F8NO5S/c1-2-17-15-22(11-12-23(17)30)44(42,43)26(13-14-38(16-26)24(39)18-3-5-19(6-4-18)25(40)41)20-7-9-21(10-8-20)27(31,28(32,33)34)29(35,36)37/h7-12,15,18-19H,2-6,13-14,16H2,1H3,(H,40,41)/t18?,19?,26-/m0/s1 |
| InChIKey | IMASCFKPOMBBQD-CPHAMLGRSA-N |
| XLogP | 6.47 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |