C31H21F9N4O3S — CID 118217613
2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 118217613) has the molecular formula C31H21F9N4O3S and a molecular weight of 700.58 g/mol. Its IUPAC name is 2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 118217613 |
| Molecular Formula | C31H21F9N4O3S |
| Molecular Weight | 700.58 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | 2-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(N2CC[C@](c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)nc1 |
| InChI | InChI=1S/C31H21F9N4O3S/c32-22-8-10-23(11-9-22)48(45,46)28(12-13-44(18-28)27-42-15-19(14-41)16-43-27)20-4-6-21(7-5-20)29(30(35,36)37,31(38,39)40)47-17-24-25(33)2-1-3-26(24)34/h1-11,15-16H,12-13,17-18H2/t28-/m0/s1 |
| InChIKey | BGIMWUINTMBXKQ-NDEPHWFRSA-N |
| XLogP | 6.88 |
| TPSA | 96.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |