C34H30F9NO6S — CID 118217646
4-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118217646) has the molecular formula C34H30F9NO6S and a molecular weight of 751.66 g/mol. Its IUPAC name is 4-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118217646 |
| Molecular Formula | C34H30F9NO6S |
| Molecular Weight | 751.66 g/mol |
| Exact Mass | 751.17 |
| IUPAC Name | 4-[(3R)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CC[C@](c3ccc(C(OCc4c(F)cccc4F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C34H30F9NO6S/c35-24-12-14-25(15-13-24)51(48,49)31(16-17-44(19-31)29(45)20-4-6-21(7-5-20)30(46)47)22-8-10-23(11-9-22)32(33(38,39)40,34(41,42)43)50-18-26-27(36)2-1-3-28(26)37/h1-3,8-15,20-21H,4-7,16-19H2,(H,46,47)/t20?,21?,31-/m0/s1 |
| InChIKey | BFZCOFNHRDYFJK-RNNXAFDXSA-N |
| XLogP | 7.43 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |