C28H23F8NO5S — CID 118217696
methyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate (PubChem CID 118217696) has the molecular formula C28H23F8NO5S and a molecular weight of 637.55 g/mol. Its IUPAC name is methyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | methyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118217696 |
| Molecular Formula | C28H23F8NO5S |
| Molecular Weight | 637.55 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | methyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C28H23F8NO5S/c1-41-24(38)37-15-14-25(17-37,43(39,40)20-6-3-2-4-7-20)18-10-12-19(13-11-18)26(27(31,32)33,28(34,35)36)42-16-21-22(29)8-5-9-23(21)30/h2-13H,14-17H2,1H3 |
| InChIKey | DTRHJSKHNGYSQT-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |