C28H22F9NO5S — CID 118217697
methyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate (PubChem CID 118217697) has the molecular formula C28H22F9NO5S and a molecular weight of 655.54 g/mol. Its IUPAC name is methyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate.
| Compound Name | methyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118217697 |
| Molecular Formula | C28H22F9NO5S |
| Molecular Weight | 655.54 g/mol |
| Exact Mass | 655.11 |
| IUPAC Name | methyl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C28H22F9NO5S/c1-42-24(39)38-14-13-25(16-38,44(40,41)20-11-9-19(29)10-12-20)17-5-7-18(8-6-17)26(27(32,33)34,28(35,36)37)43-15-21-22(30)3-2-4-23(21)31/h2-12H,13-16H2,1H3 |
| InChIKey | OJBRTFLFQNWABZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |