C30H26F9NO5S — CID 118217698
propan-2-yl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate (PubChem CID 118217698) has the molecular formula C30H26F9NO5S and a molecular weight of 683.59 g/mol. Its IUPAC name is propan-2-yl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate.
| Compound Name | propan-2-yl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118217698 |
| Molecular Formula | C30H26F9NO5S |
| Molecular Weight | 683.59 g/mol |
| Exact Mass | 683.14 |
| IUPAC Name | propan-2-yl 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C30H26F9NO5S/c1-18(2)45-26(41)40-15-14-27(17-40,46(42,43)22-12-10-21(31)11-13-22)19-6-8-20(9-7-19)28(29(34,35)36,30(37,38)39)44-16-23-24(32)4-3-5-25(23)33/h3-13,18H,14-17H2,1-2H3 |
| InChIKey | MTONLKUQYTWONS-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.59 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |