C31H29F8NO5S — CID 118217699
tert-butyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate (PubChem CID 118217699) has the molecular formula C31H29F8NO5S and a molecular weight of 679.63 g/mol. Its IUPAC name is tert-butyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118217699 |
| Molecular Formula | C31H29F8NO5S |
| Molecular Weight | 679.63 g/mol |
| Exact Mass | 679.16 |
| IUPAC Name | tert-butyl 3-(benzenesulfonyl)-3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C31H29F8NO5S/c1-27(2,3)45-26(41)40-17-16-28(19-40,46(42,43)22-8-5-4-6-9-22)20-12-14-21(15-13-20)29(30(34,35)36,31(37,38)39)44-18-23-24(32)10-7-11-25(23)33/h4-15H,16-19H2,1-3H3 |
| InChIKey | BWRYBGPLJSGTBO-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.63 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |