C29H20F8N2O3S — CID 118217861
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-quinolin-6-ylmethanone (PubChem CID 118217861) has the molecular formula C29H20F8N2O3S and a molecular weight of 628.54 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-quinolin-6-ylmethanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 118217861 |
| Molecular Formula | C29H20F8N2O3S |
| Molecular Weight | 628.54 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-quinolin-6-ylmethanone |
| SMILES | O=C(c1ccc2ncccc2c1)N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C29H20F8N2O3S/c30-22-8-10-23(11-9-22)43(41,42)26(20-4-6-21(7-5-20)27(31,28(32,33)34)29(35,36)37)13-15-39(17-26)25(40)19-3-12-24-18(16-19)2-1-14-38-24/h1-12,14,16H,13,15,17H2/t26-/m0/s1 |
| InChIKey | MDBQEINWXLSXET-SANMLTNESA-N |
| XLogP | 6.88 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.54 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |