C24H21F8NO5S2 — CID 118217915
(1,1-dioxothiolan-3-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118217915) has the molecular formula C24H21F8NO5S2 and a molecular weight of 619.55 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | (1,1-dioxothiolan-3-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118217915 |
| Molecular Formula | C24H21F8NO5S2 |
| Molecular Weight | 619.55 g/mol |
| Exact Mass | 619.07 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H21F8NO5S2/c25-18-5-7-19(8-6-18)40(37,38)21(10-11-33(14-21)20(34)15-9-12-39(35,36)13-15)16-1-3-17(4-2-16)22(26,23(27,28)29)24(30,31)32/h1-8,15H,9-14H2/t15?,21-/m0/s1 |
| InChIKey | QABINSUJKJJFAK-FXMQYSIJSA-N |
| XLogP | 4.45 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |