C26H21F8NO2S — CID 118217936
1-benzyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine (PubChem CID 118217936) has the molecular formula C26H21F8NO2S and a molecular weight of 563.51 g/mol. Its IUPAC name is 1-benzyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine.
| Compound Name | 1-benzyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 118217936 |
| Molecular Formula | C26H21F8NO2S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | 1-benzyl-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H21F8NO2S/c27-21-10-12-22(13-11-21)38(36,37)23(14-15-35(17-23)16-18-4-2-1-3-5-18)19-6-8-20(9-7-19)24(28,25(29,30)31)26(32,33)34/h1-13H,14-17H2 |
| InChIKey | POPVGYXNCKMUSW-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |