C26H36NO2+ — CID 118218039
[3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium (PubChem CID 118218039) has the molecular formula C26H36NO2+ and a molecular weight of 394.58 g/mol. Its IUPAC name is [3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium.
| Compound Name | [3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 118218039 |
| Molecular Formula | C26H36NO2+ |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [3-[(1Z,3E,5E,7E)-deca-1,3,5,7,9-pentaenoxy]-2-[(3E,5E,7E)-deca-1,3,5,7,9-pentaen-2-yl]oxypropyl]-trimethylazanium |
| SMILES | C=C/C=C/C=C/C=C/C=C\OCC(C[N+](C)(C)C)OC(=C)/C=C/C=C/C=C/C=C |
| InChI | InChI=1S/C26H36NO2/c1-7-9-11-13-15-16-18-20-22-28-24-26(23-27(4,5)6)29-25(3)21-19-17-14-12-10-8-2/h7-22,26H,1-3,23-24H2,4-6H3/q+1/b11-9+,12-10+,15-13+,17-14+,18-16+,21-19+,22-20- |
| InChIKey | VXGGRSZOFANLLY-IIWHRLECSA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|