C30H25BrFN3O2 — CID 118218168
1-(7-bromo-4-fluoro-1H-indol-3-yl)-2-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethane-1,2-dione (PubChem CID 118218168) has the molecular formula C30H25BrFN3O2 and a molecular weight of 558.45 g/mol. Its IUPAC name is 1-(7-bromo-4-fluoro-1H-indol-3-yl)-2-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethane-1,2-dione.
| Compound Name | 1-(7-bromo-4-fluoro-1H-indol-3-yl)-2-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 118218168 |
| Molecular Formula | C30H25BrFN3O2 |
| Molecular Weight | 558.45 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | 1-(7-bromo-4-fluoro-1H-indol-3-yl)-2-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethane-1,2-dione |
| SMILES | Cc1ccc2c(c1)CCc1cccnc1C2=C1CCN(C(=O)C(=O)c2c[nH]c3c(Br)ccc(F)c23)CC1 |
| InChI | InChI=1S/C30H25BrFN3O2/c1-17-4-7-21-20(15-17)6-5-19-3-2-12-33-27(19)25(21)18-10-13-35(14-11-18)30(37)29(36)22-16-34-28-23(31)8-9-24(32)26(22)28/h2-4,7-9,12,15-16,34H,5-6,10-11,13-14H2,1H3 |
| InChIKey | AUOGJOHLQWKOPT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.45 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|