C28H28ClN5O3S — CID 118218209
N-[5-[4-[5-[[2-(2-chlorophenyl)acetyl]amino]-2-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide (PubChem CID 118218209) has the molecular formula C28H28ClN5O3S and a molecular weight of 550.08 g/mol. Its IUPAC name is N-[5-[4-[5-[[2-(2-chlorophenyl)acetyl]amino]-2-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide.
| Compound Name | N-[5-[4-[5-[[2-(2-chlorophenyl)acetyl]amino]-2-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 118218209 |
| Molecular Formula | C28H28ClN5O3S |
| Molecular Weight | 550.08 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | N-[5-[4-[5-[[2-(2-chlorophenyl)acetyl]amino]-2-pyridinyl]butyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1CC(=O)Nc1nnc(CCCCc2ccc(NC(=O)Cc3ccccc3Cl)cn2)s1 |
| InChI | InChI=1S/C28H28ClN5O3S/c1-37-24-12-6-3-9-20(24)17-26(36)32-28-34-33-27(38-28)13-7-4-10-21-14-15-22(18-30-21)31-25(35)16-19-8-2-5-11-23(19)29/h2-3,5-6,8-9,11-12,14-15,18H,4,7,10,13,16-17H2,1H3,(H,31,35)(H,32,34,36) |
| InChIKey | YMXKDSMGCSPJAJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.08 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|