About 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide
2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide (PubChem CID 118218247) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide |
| PubChem CID | 118218247 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide |
| SMILES | C[C@H]1C=C(CC(N)=O)C=CC1 |
| InChI | InChI=1S/C9H13NO/c1-7-3-2-4-8(5-7)6-9(10)11/h2,4-5,7H,3,6H2,1H3,(H2,10,11)/t7-/m1/s1 |
| InChIKey | AAUDBLVULOINDB-SSDOTTSWSA-N |
| XLogP | 1.38 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide?
The IUPAC name of 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide (CID 118218247) is 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide.
What is the SMILES notation for 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide?
The canonical SMILES for 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide is C[C@H]1C=C(CC(N)=O)C=CC1.
What is the InChIKey of 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide?
The InChIKey is AAUDBLVULOINDB-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H13NO/c1-7-3-2-4-8(5-7)6-9(10)11/h2,4-5,7H,3,6H2,1H3,(H2,10,11)/t7-/m1/s1.
What are the key properties of 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide?
2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide has a molecular weight of 151.21 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-3-methylcyclohexa-1,5-dien-1-yl]acetamide is sourced from PubChem (CID 118218247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).