About 5-ethyl-3,7-dimethyl-4H-azepine
5-ethyl-3,7-dimethyl-4H-azepine (PubChem CID 118218279) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 5-ethyl-3,7-dimethyl-4H-azepine.
Molecular Properties
| Compound Name | 5-ethyl-3,7-dimethyl-4H-azepine |
| PubChem CID | 118218279 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 5-ethyl-3,7-dimethyl-4H-azepine |
| SMILES | CCC1=CC(C)=NC=C(C)C1 |
| InChI | InChI=1S/C10H15N/c1-4-10-5-8(2)7-11-9(3)6-10/h6-7H,4-5H2,1-3H3 |
| InChIKey | SKUDYEAMFAEZNM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-ethyl-3,7-dimethyl-4H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,7-dimethyl-4H-azepine?
The IUPAC name of 5-ethyl-3,7-dimethyl-4H-azepine (CID 118218279) is 5-ethyl-3,7-dimethyl-4H-azepine.
What is the SMILES notation for 5-ethyl-3,7-dimethyl-4H-azepine?
The canonical SMILES for 5-ethyl-3,7-dimethyl-4H-azepine is CCC1=CC(C)=NC=C(C)C1.
What is the InChIKey of 5-ethyl-3,7-dimethyl-4H-azepine?
The InChIKey is SKUDYEAMFAEZNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-4-10-5-8(2)7-11-9(3)6-10/h6-7H,4-5H2,1-3H3.
What are the key properties of 5-ethyl-3,7-dimethyl-4H-azepine?
5-ethyl-3,7-dimethyl-4H-azepine has a molecular weight of 149.24 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,7-dimethyl-4H-azepine is sourced from PubChem (CID 118218279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).