C20H20F6O3S — CID 118218280
1-(benzenesulfonylmethyl)-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene (PubChem CID 118218280) has the molecular formula C20H20F6O3S and a molecular weight of 454.43 g/mol. Its IUPAC name is 1-(benzenesulfonylmethyl)-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene.
| Compound Name | 1-(benzenesulfonylmethyl)-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene |
|---|---|
| PubChem CID | 118218280 |
| Molecular Formula | C20H20F6O3S |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-(benzenesulfonylmethyl)-4-(2-butoxy-1,1,1,3,3,3-hexafluoropropan-2-yl)benzene |
| SMILES | CCCCOC(c1ccc(CS(=O)(=O)c2ccccc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H20F6O3S/c1-2-3-13-29-18(19(21,22)23,20(24,25)26)16-11-9-15(10-12-16)14-30(27,28)17-7-5-4-6-8-17/h4-12H,2-3,13-14H2,1H3 |
| InChIKey | XXNSFGJYSUXHCB-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|