C18H30NS+ — CID 118218593
1,2-dimethyl-1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidin-1-ium (PubChem CID 118218593) has the molecular formula C18H30NS+ and a molecular weight of 292.51 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidin-1-ium.
| Compound Name | 1,2-dimethyl-1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidin-1-ium |
|---|---|
| PubChem CID | 118218593 |
| Molecular Formula | C18H30NS+ |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 1,2-dimethyl-1-[(1R,2S)-2-methyl-1-thiophen-2-ylcyclohexyl]piperidin-1-ium |
| SMILES | CC1CCCC[N+]1(C)[C@]1(c2cccs2)CCCC[C@@H]1C |
| InChI | InChI=1S/C18H30NS/c1-15-9-4-6-12-18(15,17-11-8-14-20-17)19(3)13-7-5-10-16(19)2/h8,11,14-16H,4-7,9-10,12-13H2,1-3H3/q+1/t15-,16?,18+,19?/m0/s1 |
| InChIKey | CEEDZXRNCHNBLW-MEWCUZTCSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|