C29H21F9O5S — CID 118218810
5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carbaldehyde (PubChem CID 118218810) has the molecular formula C29H21F9O5S and a molecular weight of 652.53 g/mol. Its IUPAC name is 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carbaldehyde.
| Compound Name | 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 118218810 |
| Molecular Formula | C29H21F9O5S |
| Molecular Weight | 652.53 g/mol |
| Exact Mass | 652.10 |
| IUPAC Name | 5-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-5-(4-fluorophenyl)sulfonyl-2-oxocyclohexane-1-carbaldehyde |
| SMILES | O=CC1CC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CCC1=O |
| InChI | InChI=1S/C29H21F9O5S/c30-20-8-10-21(11-9-20)44(41,42)26(13-12-25(40)17(14-26)15-39)18-4-6-19(7-5-18)27(28(33,34)35,29(36,37)38)43-16-22-23(31)2-1-3-24(22)32/h1-11,15,17H,12-14,16H2 |
| InChIKey | KNPLXLWBXFMDBO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.53 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|