C29H26F8N2O3S — CID 118218840
4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(2-pyridin-4-ylethyl)cyclohexane-1-carboxamide (PubChem CID 118218840) has the molecular formula C29H26F8N2O3S and a molecular weight of 634.59 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(2-pyridin-4-ylethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(2-pyridin-4-ylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118218840 |
| Molecular Formula | C29H26F8N2O3S |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.15 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(2-pyridin-4-ylethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCCc1ccncc1)C1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H26F8N2O3S/c30-23-5-7-24(8-6-23)43(41,42)26(21-1-3-22(4-2-21)27(31,28(32,33)34)29(35,36)37)14-9-20(10-15-26)25(40)39-18-13-19-11-16-38-17-12-19/h1-8,11-12,16-17,20H,9-10,13-15,18H2,(H,39,40) |
| InChIKey | KCZQPHMHDGEEBG-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |