C28H24F8N2O3S — CID 118218895
4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(pyridin-4-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 118218895) has the molecular formula C28H24F8N2O3S and a molecular weight of 620.56 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(pyridin-4-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(pyridin-4-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118218895 |
| Molecular Formula | C28H24F8N2O3S |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-N-(pyridin-4-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1ccncc1)C1CCC(c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H24F8N2O3S/c29-22-5-7-23(8-6-22)42(40,41)25(13-9-19(10-14-25)24(39)38-17-18-11-15-37-16-12-18)20-1-3-21(4-2-20)26(30,27(31,32)33)28(34,35)36/h1-8,11-12,15-16,19H,9-10,13-14,17H2,(H,38,39) |
| InChIKey | WIASAJCUWPMOHM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |