C27H30F7NO5S — CID 118218921
tert-butyl N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamate (PubChem CID 118218921) has the molecular formula C27H30F7NO5S and a molecular weight of 613.59 g/mol. Its IUPAC name is tert-butyl N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 118218921 |
| Molecular Formula | C27H30F7NO5S |
| Molecular Weight | 613.59 g/mol |
| Exact Mass | 613.17 |
| IUPAC Name | tert-butyl N-[4-(4-fluorophenyl)sulfonyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-1-methylcyclohexyl]carbamate |
| SMILES | CC1(NC(=O)OC(C)(C)C)CCC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C27H30F7NO5S/c1-22(2,3)40-21(36)35-23(4)13-15-24(16-14-23,41(38,39)20-11-9-19(28)10-12-20)17-5-7-18(8-6-17)25(37,26(29,30)31)27(32,33)34/h5-12,37H,13-16H2,1-4H3,(H,35,36) |
| InChIKey | RWCRGGMGGFHEGJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |