C27H21F9O4S — CID 118219068
4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyloxane (PubChem CID 118219068) has the molecular formula C27H21F9O4S and a molecular weight of 612.51 g/mol. Its IUPAC name is 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyloxane.
| Compound Name | 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyloxane |
|---|---|
| PubChem CID | 118219068 |
| Molecular Formula | C27H21F9O4S |
| Molecular Weight | 612.51 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyloxane |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CCOCC1 |
| InChI | InChI=1S/C27H21F9O4S/c28-19-8-10-20(11-9-19)41(37,38)24(12-14-39-15-13-24)17-4-6-18(7-5-17)25(26(31,32)33,27(34,35)36)40-16-21-22(29)2-1-3-23(21)30/h1-11H,12-16H2 |
| InChIKey | UJYPJXGRUNXLOK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |