C28H24F9NO5S2 — CID 118219073
4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-methylsulfonylpiperidine (PubChem CID 118219073) has the molecular formula C28H24F9NO5S2 and a molecular weight of 689.62 g/mol. Its IUPAC name is 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-methylsulfonylpiperidine.
| Compound Name | 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 118219073 |
| Molecular Formula | C28H24F9NO5S2 |
| Molecular Weight | 689.62 g/mol |
| Exact Mass | 689.10 |
| IUPAC Name | 4-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-4-(4-fluorophenyl)sulfonyl-1-methylsulfonylpiperidine |
| SMILES | CS(=O)(=O)N1CCC(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C28H24F9NO5S2/c1-44(39,40)38-15-13-25(14-16-38,45(41,42)21-11-9-20(29)10-12-21)18-5-7-19(8-6-18)26(27(32,33)34,28(35,36)37)43-17-22-23(30)3-2-4-24(22)31/h2-12H,13-17H2,1H3 |
| InChIKey | FSKOLIJAFIURGL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |