C19H20FNO2 — CID 118219373
ethyl 3-fluoro-4-[(2-methyl-1H-indol-3-yl)methyl]cyclohexa-1,3-diene-1-carboxylate (PubChem CID 118219373) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is ethyl 3-fluoro-4-[(2-methyl-1H-indol-3-yl)methyl]cyclohexa-1,3-diene-1-carboxylate.
| Compound Name | ethyl 3-fluoro-4-[(2-methyl-1H-indol-3-yl)methyl]cyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 118219373 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | ethyl 3-fluoro-4-[(2-methyl-1H-indol-3-yl)methyl]cyclohexa-1,3-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC(F)=C(Cc2c(C)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C19H20FNO2/c1-3-23-19(22)14-9-8-13(17(20)11-14)10-16-12(2)21-18-7-5-4-6-15(16)18/h4-7,11,21H,3,8-10H2,1-2H3 |
| InChIKey | PXLYGERHDICVOH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|