C18H17NO2 — CID 11821981
2-methyl-6-nitro-12-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),10,12-heptaene (PubChem CID 11821981) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-methyl-6-nitro-12-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),10,12-heptaene.
| Compound Name | 2-methyl-6-nitro-12-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),10,12-heptaene |
|---|---|
| PubChem CID | 11821981 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-methyl-6-nitro-12-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),10,12-heptaene |
| SMILES | Cc1cc2cc([N+](=O)[O-])ccc3ccc(C(C)C)cc1c32 |
| InChI | InChI=1S/C18H17NO2/c1-11(2)14-5-4-13-6-7-16(19(20)21)9-15-8-12(3)17(10-14)18(13)15/h4-11H,1-3H3 |
| InChIKey | GWBZWMTYTBHYPL-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azulene(4)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|