C34H27F7O4S — CID 118220697
[4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-phenylmethanone (PubChem CID 118220697) has the molecular formula C34H27F7O4S and a molecular weight of 664.64 g/mol. Its IUPAC name is [4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-phenylmethanone.
| Compound Name | [4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 118220697 |
| Molecular Formula | C34H27F7O4S |
| Molecular Weight | 664.64 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | [4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C34H27F7O4S/c35-28-16-18-29(19-17-28)46(43,44)31(20-4-5-21-31)26-12-14-27(15-13-26)32(33(36,37)38,34(39,40)41)45-22-23-8-10-25(11-9-23)30(42)24-6-2-1-3-7-24/h1-3,6-19H,4-5,20-22H2 |
| InChIKey | MYYVCEJUDKJDTJ-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.64 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |