C28H25F7O5S2 — CID 118220699
1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylsulfonylbenzene (PubChem CID 118220699) has the molecular formula C28H25F7O5S2 and a molecular weight of 638.62 g/mol. Its IUPAC name is 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylsulfonylbenzene.
| Compound Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylsulfonylbenzene |
|---|---|
| PubChem CID | 118220699 |
| Molecular Formula | C28H25F7O5S2 |
| Molecular Weight | 638.62 g/mol |
| Exact Mass | 638.10 |
| IUPAC Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-4-methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1ccc(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H25F7O5S2/c1-41(36,37)23-12-4-19(5-13-23)18-40-26(27(30,31)32,28(33,34)35)21-8-6-20(7-9-21)25(16-2-3-17-25)42(38,39)24-14-10-22(29)11-15-24/h4-15H,2-3,16-18H2,1H3 |
| InChIKey | BESWFCIFDKNTDW-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |