C28H24F7NO4S — CID 118220703
4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzamide (PubChem CID 118220703) has the molecular formula C28H24F7NO4S and a molecular weight of 603.56 g/mol. Its IUPAC name is 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzamide.
| Compound Name | 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzamide |
|---|---|
| PubChem CID | 118220703 |
| Molecular Formula | C28H24F7NO4S |
| Molecular Weight | 603.56 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzamide |
| SMILES | NC(=O)c1ccc(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H24F7NO4S/c29-22-11-13-23(14-12-22)41(38,39)25(15-1-2-16-25)20-7-9-21(10-8-20)26(27(30,31)32,28(33,34)35)40-17-18-3-5-19(6-4-18)24(36)37/h3-14H,1-2,15-17H2,(H2,36,37) |
| InChIKey | RQJLLBFLPXKKDO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |