C29H25F7O5S — CID 118220708
methyl 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate (PubChem CID 118220708) has the molecular formula C29H25F7O5S and a molecular weight of 618.57 g/mol. Its IUPAC name is methyl 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 118220708 |
| Molecular Formula | C29H25F7O5S |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | methyl 4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(c2ccc(C3(S(=O)(=O)c4ccc(F)cc4)CCCC3)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H25F7O5S/c1-40-25(37)20-6-4-19(5-7-20)18-41-27(28(31,32)33,29(34,35)36)22-10-8-21(9-11-22)26(16-2-3-17-26)42(38,39)24-14-12-23(30)13-15-24/h4-15H,2-3,16-18H2,1H3 |
| InChIKey | SOEUUZRWXBNVBX-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |