C29H25F7N2O4S — CID 118220723
[3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclobutyl]-(3-pyridin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 118220723) has the molecular formula C29H25F7N2O4S and a molecular weight of 630.58 g/mol. Its IUPAC name is [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclobutyl]-(3-pyridin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclobutyl]-(3-pyridin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 118220723 |
| Molecular Formula | C29H25F7N2O4S |
| Molecular Weight | 630.58 g/mol |
| Exact Mass | 630.14 |
| IUPAC Name | [3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclobutyl]-(3-pyridin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(C1CC(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1)N1CCC(c2ccncc2)C1 |
| InChI | InChI=1S/C29H25F7N2O4S/c30-23-5-7-24(8-6-23)43(41,42)26(21-1-3-22(4-2-21)27(40,28(31,32)33)29(34,35)36)15-20(16-26)25(39)38-14-11-19(17-38)18-9-12-37-13-10-18/h1-10,12-13,19-20,40H,11,14-17H2 |
| InChIKey | JPGRHZHYFZGUID-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.58 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |