C28H22F10O3S — CID 118220749
1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethyl)benzene (PubChem CID 118220749) has the molecular formula C28H22F10O3S and a molecular weight of 628.53 g/mol. Its IUPAC name is 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 118220749 |
| Molecular Formula | C28H22F10O3S |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethyl)benzene |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3ccccc3C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C28H22F10O3S/c29-21-11-13-22(14-12-21)42(39,40)24(15-3-4-16-24)19-7-9-20(10-8-19)25(27(33,34)35,28(36,37)38)41-17-18-5-1-2-6-23(18)26(30,31)32/h1-2,5-14H,3-4,15-17H2 |
| InChIKey | IZJCPWCNFQWZNA-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |