C28H22F7NO3S — CID 118220756
2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzonitrile (PubChem CID 118220756) has the molecular formula C28H22F7NO3S and a molecular weight of 585.54 g/mol. Its IUPAC name is 2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzonitrile.
| Compound Name | 2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 118220756 |
| Molecular Formula | C28H22F7NO3S |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | 2-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]benzonitrile |
| SMILES | N#Cc1ccccc1COC(c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H22F7NO3S/c29-23-11-13-24(14-12-23)40(37,38)25(15-3-4-16-25)21-7-9-22(10-8-21)26(27(30,31)32,28(33,34)35)39-18-20-6-2-1-5-19(20)17-36/h1-2,5-14H,3-4,15-16,18H2 |
| InChIKey | SXDNMIOVAAUQPF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |