C28H22F10O4S — CID 118220765
1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethoxy)benzene (PubChem CID 118220765) has the molecular formula C28H22F10O4S and a molecular weight of 644.53 g/mol. Its IUPAC name is 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 118220765 |
| Molecular Formula | C28H22F10O4S |
| Molecular Weight | 644.53 g/mol |
| Exact Mass | 644.11 |
| IUPAC Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-(trifluoromethoxy)benzene |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3ccccc3OC(F)(F)F)(C(F)(F)F)C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C28H22F10O4S/c29-21-11-13-22(14-12-21)43(39,40)24(15-3-4-16-24)19-7-9-20(10-8-19)25(26(30,31)32,27(33,34)35)41-17-18-5-1-2-6-23(18)42-28(36,37)38/h1-2,5-14H,3-4,15-17H2 |
| InChIKey | LKEFVRSHLPQXBX-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.53 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |