C33H27F7O3S — CID 118220767
1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-phenylbenzene (PubChem CID 118220767) has the molecular formula C33H27F7O3S and a molecular weight of 636.63 g/mol. Its IUPAC name is 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-phenylbenzene.
| Compound Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-phenylbenzene |
|---|---|
| PubChem CID | 118220767 |
| Molecular Formula | C33H27F7O3S |
| Molecular Weight | 636.63 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-phenylbenzene |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3ccccc3-c3ccccc3)(C(F)(F)F)C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C33H27F7O3S/c34-27-16-18-28(19-17-27)44(41,42)30(20-6-7-21-30)25-12-14-26(15-13-25)31(32(35,36)37,33(38,39)40)43-22-24-10-4-5-11-29(24)23-8-2-1-3-9-23/h1-5,8-19H,6-7,20-22H2 |
| InChIKey | LFDKDSDZUDCKSM-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.63 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |