C23H21F7O3S — CID 118220774
1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)benzene (PubChem CID 118220774) has the molecular formula C23H21F7O3S and a molecular weight of 510.47 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)benzene.
| Compound Name | 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)benzene |
|---|---|
| PubChem CID | 118220774 |
| Molecular Formula | C23H21F7O3S |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-(1,1,1,3,3,3-hexafluoro-2-prop-2-enoxypropan-2-yl)benzene |
| SMILES | C=CCOC(c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H21F7O3S/c1-2-15-33-21(22(25,26)27,23(28,29)30)17-7-5-16(6-8-17)20(13-3-4-14-20)34(31,32)19-11-9-18(24)10-12-19/h2,5-12H,1,3-4,13-15H2 |
| InChIKey | MBRBOTNFDXVHHT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|