C28H25F7O3S — CID 118220777
1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-methylbenzene (PubChem CID 118220777) has the molecular formula C28H25F7O3S and a molecular weight of 574.56 g/mol. Its IUPAC name is 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-methylbenzene.
| Compound Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-methylbenzene |
|---|---|
| PubChem CID | 118220777 |
| Molecular Formula | C28H25F7O3S |
| Molecular Weight | 574.56 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | 1-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]-2-methylbenzene |
| SMILES | Cc1ccccc1COC(c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H25F7O3S/c1-19-6-2-3-7-20(19)18-38-26(27(30,31)32,28(33,34)35)22-10-8-21(9-11-22)25(16-4-5-17-25)39(36,37)24-14-12-23(29)13-15-24/h2-3,6-15H,4-5,16-18H2,1H3 |
| InChIKey | JQRLHKYSZJBRMY-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.56 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |