C23H23F7O4S — CID 118220789
1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxy)propan-2-yl]benzene (PubChem CID 118220789) has the molecular formula C23H23F7O4S and a molecular weight of 528.49 g/mol. Its IUPAC name is 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxy)propan-2-yl]benzene.
| Compound Name | 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxy)propan-2-yl]benzene |
|---|---|
| PubChem CID | 118220789 |
| Molecular Formula | C23H23F7O4S |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 1-[1-(4-fluorophenyl)sulfonylcyclopentyl]-4-[1,1,1,3,3,3-hexafluoro-2-(2-methoxyethoxy)propan-2-yl]benzene |
| SMILES | COCCOC(c1ccc(C2(S(=O)(=O)c3ccc(F)cc3)CCCC2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H23F7O4S/c1-33-14-15-34-21(22(25,26)27,23(28,29)30)17-6-4-16(5-7-17)20(12-2-3-13-20)35(31,32)19-10-8-18(24)9-11-19/h4-11H,2-3,12-15H2,1H3 |
| InChIKey | MCANDXITAIDMRL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|