C20H17F7O4S — CID 118220814
cis-(1S,3S)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclopentan-1-ol (PubChem CID 118220814) has the molecular formula C20H17F7O4S and a molecular weight of 486.41 g/mol. Its IUPAC name is cis-(1S,3S)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclopentan-1-ol.
| Compound Name | cis-(1S,3S)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 118220814 |
| Molecular Formula | C20H17F7O4S |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | cis-(1S,3S)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]cyclopentan-1-ol |
| SMILES | O=S(=O)(c1ccc(F)cc1)[C@@]1(c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)CC[C@H](O)C1 |
| InChI | InChI=1S/C20H17F7O4S/c21-14-5-7-16(8-6-14)32(30,31)17(10-9-15(28)11-17)12-1-3-13(4-2-12)18(29,19(22,23)24)20(25,26)27/h1-8,15,28-29H,9-11H2/t15-,17-/m0/s1 |
| InChIKey | CKROEYDCOBETOF-RDJZCZTQSA-N |
| XLogP | 4.35 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |