C30H23F8NO4S — CID 118220852
2-[2-fluoro-4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-1,3-oxazole (PubChem CID 118220852) has the molecular formula C30H23F8NO4S and a molecular weight of 645.57 g/mol. Its IUPAC name is 2-[2-fluoro-4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-1,3-oxazole.
| Compound Name | 2-[2-fluoro-4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 118220852 |
| Molecular Formula | C30H23F8NO4S |
| Molecular Weight | 645.57 g/mol |
| Exact Mass | 645.12 |
| IUPAC Name | 2-[2-fluoro-4-[[1,1,1,3,3,3-hexafluoro-2-[4-[1-(4-fluorophenyl)sulfonylcyclopentyl]phenyl]propan-2-yl]oxymethyl]phenyl]-1,3-oxazole |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3ccc(-c4ncco4)c(F)c3)(C(F)(F)F)C(F)(F)F)cc2)CCCC1 |
| InChI | InChI=1S/C30H23F8NO4S/c31-22-8-10-23(11-9-22)44(40,41)27(13-1-2-14-27)20-4-6-21(7-5-20)28(29(33,34)35,30(36,37)38)43-18-19-3-12-24(25(32)17-19)26-39-15-16-42-26/h3-12,15-17H,1-2,13-14,18H2 |
| InChIKey | CYKAFNSPVUWKSC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.57 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |